C23H25N5 — CID 118026028
5-[(5R)-3-methyl-5-(1-pyridin-2-ylethylamino)piperidin-1-yl]quinoline-8-carbonitrile (PubChem CID 118026028) has the molecular formula C23H25N5 and a molecular weight of 371.49 g/mol. Its IUPAC name is 5-[(5R)-3-methyl-5-(1-pyridin-2-ylethylamino)piperidin-1-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(5R)-3-methyl-5-(1-pyridin-2-ylethylamino)piperidin-1-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 118026028 |
| Molecular Formula | C23H25N5 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 5-[(5R)-3-methyl-5-(1-pyridin-2-ylethylamino)piperidin-1-yl]quinoline-8-carbonitrile |
| SMILES | CC1C[C@@H](NC(C)c2ccccn2)CN(c2ccc(C#N)c3ncccc23)C1 |
| InChI | InChI=1S/C23H25N5/c1-16-12-19(27-17(2)21-7-3-4-10-25-21)15-28(14-16)22-9-8-18(13-24)23-20(22)6-5-11-26-23/h3-11,16-17,19,27H,12,14-15H2,1-2H3/t16?,17?,19-/m1/s1 |
| InChIKey | RDPKDSKQGOIHDG-FAFZWHIHSA-N |
| XLogP | 4.07 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |