C20H26N10O14P2 — CID 11802779
[(2R,3S,5R)-5-(2-amino-4-hydroxy-6,8-dioxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-phosphonooxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 11802779) has the molecular formula C20H26N10O14P2 and a molecular weight of 692.43 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(2-amino-4-hydroxy-6,8-dioxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-phosphonooxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(2-amino-4-hydroxy-6,8-dioxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-phosphonooxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 11802779 |
| Molecular Formula | C20H26N10O14P2 |
| Molecular Weight | 692.43 g/mol |
| Exact Mass | 692.11 |
| IUPAC Name | [(2R,3S,5R)-5-(2-amino-4-hydroxy-6,8-dioxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-phosphonooxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | NC1=NC2(O)C(=NC(=O)N2[C@H]2C[C@H](OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)C[C@@H]3OP(=O)(O)O)[C@@H](CO)O2)C(=O)N1 |
| InChI | InChI=1S/C20H26N10O14P2/c21-15-13-16(24-5-23-15)29(6-25-13)11-1-8(43-45(35,36)37)10(42-11)4-40-46(38,39)44-7-2-12(41-9(7)3-31)30-19(33)26-14-17(32)27-18(22)28-20(14,30)34/h5-12,31,34H,1-4H2,(H,38,39)(H2,21,23,24)(H2,35,36,37)(H3,22,27,28,32)/t7-,8-,9+,10+,11+,12+,20?/m0/s1 |
| InChIKey | QUFVOSSUFKGXAY-AJKOJGPMSA-N |
| XLogP | -3.25 |
| TPSA | 351.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.43 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|