C20H21N3O4S — CID 118028159
4-[3-(cyclopropylmethoxy)-6-ethylsulfonylpyridazin-4-yl]-2-methylisoquinolin-1-one (PubChem CID 118028159) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 4-[3-(cyclopropylmethoxy)-6-ethylsulfonylpyridazin-4-yl]-2-methylisoquinolin-1-one.
| Compound Name | 4-[3-(cyclopropylmethoxy)-6-ethylsulfonylpyridazin-4-yl]-2-methylisoquinolin-1-one |
|---|---|
| PubChem CID | 118028159 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 4-[3-(cyclopropylmethoxy)-6-ethylsulfonylpyridazin-4-yl]-2-methylisoquinolin-1-one |
| SMILES | CCS(=O)(=O)c1cc(-c2cn(C)c(=O)c3ccccc23)c(OCC2CC2)nn1 |
| InChI | InChI=1S/C20H21N3O4S/c1-3-28(25,26)18-10-16(19(22-21-18)27-12-13-8-9-13)17-11-23(2)20(24)15-7-5-4-6-14(15)17/h4-7,10-11,13H,3,8-9,12H2,1-2H3 |
| InChIKey | FVIVPUFWUKWSGB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |