C29H26F3N5O3 — CID 118028746
(3S)-N-[(3S,5S,6R)-1-ethyl-6-methyl-2-oxo-5-(2,3,5-trifluorophenyl)piperidin-3-yl]-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-carboxamide (PubChem CID 118028746) has the molecular formula C29H26F3N5O3 and a molecular weight of 549.55 g/mol. Its IUPAC name is (3S)-N-[(3S,5S,6R)-1-ethyl-6-methyl-2-oxo-5-(2,3,5-trifluorophenyl)piperidin-3-yl]-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-carboxamide.
| Compound Name | (3S)-N-[(3S,5S,6R)-1-ethyl-6-methyl-2-oxo-5-(2,3,5-trifluorophenyl)piperidin-3-yl]-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-carboxamide |
|---|---|
| PubChem CID | 118028746 |
| Molecular Formula | C29H26F3N5O3 |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | (3S)-N-[(3S,5S,6R)-1-ethyl-6-methyl-2-oxo-5-(2,3,5-trifluorophenyl)piperidin-3-yl]-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-carboxamide |
| SMILES | CCN1C(=O)[C@@H](NC(=O)c2cnc3c(c2)C[C@@]2(C3)C(=O)Nc3ncccc32)C[C@@H](c2cc(F)cc(F)c2F)[C@H]1C |
| InChI | InChI=1S/C29H26F3N5O3/c1-3-37-14(2)18(19-8-17(30)9-21(31)24(19)32)10-22(27(37)39)35-26(38)16-7-15-11-29(12-23(15)34-13-16)20-5-4-6-33-25(20)36-28(29)40/h4-9,13-14,18,22H,3,10-12H2,1-2H3,(H,35,38)(H,33,36,40)/t14-,18-,22+,29+/m1/s1 |
| InChIKey | MUVGEPVUKZHVJQ-BUJGTURPSA-N |
| XLogP | 3.41 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|