C32H29F3N2O3 — CID 160774827
(2R)-5-[2-[(3R,5S,6R)-1-ethyl-6-methyl-2-oxo-5-(2,3,5-trifluorophenyl)piperidin-3-yl]acetyl]spiro[1,3-dihydroindene-2,3'-1H-indole]-2'-one (PubChem CID 160774827) has the molecular formula C32H29F3N2O3 and a molecular weight of 546.59 g/mol. Its IUPAC name is (2R)-5-[2-[(3R,5S,6R)-1-ethyl-6-methyl-2-oxo-5-(2,3,5-trifluorophenyl)piperidin-3-yl]acetyl]spiro[1,3-dihydroindene-2,3'-1H-indole]-2'-one.
| Compound Name | (2R)-5-[2-[(3R,5S,6R)-1-ethyl-6-methyl-2-oxo-5-(2,3,5-trifluorophenyl)piperidin-3-yl]acetyl]spiro[1,3-dihydroindene-2,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 160774827 |
| Molecular Formula | C32H29F3N2O3 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | (2R)-5-[2-[(3R,5S,6R)-1-ethyl-6-methyl-2-oxo-5-(2,3,5-trifluorophenyl)piperidin-3-yl]acetyl]spiro[1,3-dihydroindene-2,3'-1H-indole]-2'-one |
| SMILES | CCN1C(=O)[C@@H](CC(=O)c2ccc3c(c2)C[C@@]2(C3)C(=O)Nc3ccccc32)C[C@@H](c2cc(F)cc(F)c2F)[C@H]1C |
| InChI | InChI=1S/C32H29F3N2O3/c1-3-37-17(2)23(24-13-22(33)14-26(34)29(24)35)11-20(30(37)39)12-28(38)18-8-9-19-15-32(16-21(19)10-18)25-6-4-5-7-27(25)36-31(32)40/h4-10,13-14,17,20,23H,3,11-12,15-16H2,1-2H3,(H,36,40)/t17-,20-,23-,32-/m1/s1 |
| InChIKey | RZUPWCPAQPGRHH-GNDUFGEXSA-N |
| XLogP | 5.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|