C16H20N2 — CID 118029493
4-buta-1,3-dien-2-yl-5-[(E)-but-2-en-2-yl]-2-[(3E)-penta-1,3-dien-3-yl]-4H-imidazole (PubChem CID 118029493) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 4-buta-1,3-dien-2-yl-5-[(E)-but-2-en-2-yl]-2-[(3E)-penta-1,3-dien-3-yl]-4H-imidazole.
| Compound Name | 4-buta-1,3-dien-2-yl-5-[(E)-but-2-en-2-yl]-2-[(3E)-penta-1,3-dien-3-yl]-4H-imidazole |
|---|---|
| PubChem CID | 118029493 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 4-buta-1,3-dien-2-yl-5-[(E)-but-2-en-2-yl]-2-[(3E)-penta-1,3-dien-3-yl]-4H-imidazole |
| SMILES | C=CC(=C)C1N=C(/C(C=C)=C/C)N=C1/C(C)=C/C |
| InChI | InChI=1S/C16H20N2/c1-7-11(5)14-15(12(6)8-2)18-16(17-14)13(9-3)10-4/h7-10,14H,1,3,5H2,2,4,6H3/b12-8+,13-10+ |
| InChIKey | BHIXDLRYMACSTA-SDCOAONHSA-N |
| XLogP | 4.05 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|