C17H22N2 — CID 118029501
4-buta-1,3-dien-2-yl-2-[(3E)-penta-1,3-dien-3-yl]-5-[(E)-pent-2-en-2-yl]-4H-imidazole (PubChem CID 118029501) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 4-buta-1,3-dien-2-yl-2-[(3E)-penta-1,3-dien-3-yl]-5-[(E)-pent-2-en-2-yl]-4H-imidazole.
| Compound Name | 4-buta-1,3-dien-2-yl-2-[(3E)-penta-1,3-dien-3-yl]-5-[(E)-pent-2-en-2-yl]-4H-imidazole |
|---|---|
| PubChem CID | 118029501 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 4-buta-1,3-dien-2-yl-2-[(3E)-penta-1,3-dien-3-yl]-5-[(E)-pent-2-en-2-yl]-4H-imidazole |
| SMILES | C=CC(=C)C1N=C(/C(C=C)=C/C)N=C1/C(C)=C/CC |
| InChI | InChI=1S/C17H22N2/c1-7-11-13(6)16-15(12(5)8-2)18-17(19-16)14(9-3)10-4/h8-11,15H,2-3,5,7H2,1,4,6H3/b13-11+,14-10+ |
| InChIKey | FRDLWOAGOVQPAQ-CKNIOMRDSA-N |
| XLogP | 4.44 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|