C15H14BrF2NO2S — CID 118030296
N-[3-bromo-4-[(2,4-difluorophenyl)methyl]phenyl]ethanesulfonamide (PubChem CID 118030296) has the molecular formula C15H14BrF2NO2S and a molecular weight of 390.25 g/mol. Its IUPAC name is N-[3-bromo-4-[(2,4-difluorophenyl)methyl]phenyl]ethanesulfonamide.
| Compound Name | N-[3-bromo-4-[(2,4-difluorophenyl)methyl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 118030296 |
| Molecular Formula | C15H14BrF2NO2S |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | N-[3-bromo-4-[(2,4-difluorophenyl)methyl]phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(Cc2ccc(F)cc2F)c(Br)c1 |
| InChI | InChI=1S/C15H14BrF2NO2S/c1-2-22(20,21)19-13-6-4-10(14(16)9-13)7-11-3-5-12(17)8-15(11)18/h3-6,8-9,19H,2,7H2,1H3 |
| InChIKey | LAWPQWAQVLDAGU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |