C36H66N2O10 — CID 118032760
5-O-[7-hydroxy-12-[[(6-hydroxy-7-propanoyloxydodecanoyl)amino]methylamino]-12-oxododecan-6-yl] 1-O-propyl pentanedioate (PubChem CID 118032760) has the molecular formula C36H66N2O10 and a molecular weight of 686.93 g/mol. Its IUPAC name is 5-O-[7-hydroxy-12-[[(6-hydroxy-7-propanoyloxydodecanoyl)amino]methylamino]-12-oxododecan-6-yl] 1-O-propyl pentanedioate.
| Compound Name | 5-O-[7-hydroxy-12-[[(6-hydroxy-7-propanoyloxydodecanoyl)amino]methylamino]-12-oxododecan-6-yl] 1-O-propyl pentanedioate |
|---|---|
| PubChem CID | 118032760 |
| Molecular Formula | C36H66N2O10 |
| Molecular Weight | 686.93 g/mol |
| Exact Mass | 686.47 |
| IUPAC Name | 5-O-[7-hydroxy-12-[[(6-hydroxy-7-propanoyloxydodecanoyl)amino]methylamino]-12-oxododecan-6-yl] 1-O-propyl pentanedioate |
| SMILES | CCCCCC(OC(=O)CC)C(O)CCCCC(=O)NCNC(=O)CCCCC(O)C(CCCCC)OC(=O)CCCC(=O)OCCC |
| InChI | InChI=1S/C36H66N2O10/c1-5-9-11-20-30(47-34(43)8-4)28(39)18-13-15-22-32(41)37-27-38-33(42)23-16-14-19-29(40)31(21-12-10-6-2)48-36(45)25-17-24-35(44)46-26-7-3/h28-31,39-40H,5-27H2,1-4H3,(H,37,41)(H,38,42) |
| InChIKey | AMMNGDHVHWYZDM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 177.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.93 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|