About 3-O-[[6-hydroxy-7-(3-oxo-3-propoxypropanoyl)oxydodecanoyl]oxymethyl] 1-O-propyl propanedioate
3-O-[[6-hydroxy-7-(3-oxo-3-propoxypropanoyl)oxydodecanoyl]oxymethyl] 1-O-propyl propanedioate (PubChem CID 118013041) has the molecular formula C25H42O11
and a molecular weight of 518.60 g/mol. Its IUPAC name is 3-O-[[6-hydroxy-7-(3-oxo-3-propoxypropanoyl)oxydodecanoyl]oxymethyl] 1-O-propyl propanedioate.
Molecular Properties
| Compound Name | 3-O-[[6-hydroxy-7-(3-oxo-3-propoxypropanoyl)oxydodecanoyl]oxymethyl] 1-O-propyl propanedioate |
| PubChem CID | 118013041 |
| Molecular Formula | C25H42O11 |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 3-O-[[6-hydroxy-7-(3-oxo-3-propoxypropanoyl)oxydodecanoyl]oxymethyl] 1-O-propyl propanedioate |
| SMILES | CCCCCC(OC(=O)CC(=O)OCCC)C(O)CCCCC(=O)OCOC(=O)CC(=O)OCCC |
| InChI | InChI=1S/C25H42O11/c1-4-7-8-12-20(36-25(31)17-23(29)33-15-6-3)19(26)11-9-10-13-21(27)34-18-35-24(30)16-22(28)32-14-5-2/h19-20,26H,4-18H2,1-3H3 |
| InChIKey | DTFZQCNJXZYFHG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-O-[[6-hydroxy-7-(3-oxo-3-propoxypropanoyl)oxydodecanoyl]oxymethyl] 1-O-propyl propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-[[6-hydroxy-7-(3-oxo-3-propoxypropanoyl)oxydodecanoyl]oxymethyl] 1-O-propyl propanedioate?
The IUPAC name of 3-O-[[6-hydroxy-7-(3-oxo-3-propoxypropanoyl)oxydodecanoyl]oxymethyl] 1-O-propyl propanedioate (CID 118013041) is 3-O-[[6-hydroxy-7-(3-oxo-3-propoxypropanoyl)oxydodecanoyl]oxymethyl] 1-O-propyl propanedioate.
What is the SMILES notation for 3-O-[[6-hydroxy-7-(3-oxo-3-propoxypropanoyl)oxydodecanoyl]oxymethyl] 1-O-propyl propanedioate?
The canonical SMILES for 3-O-[[6-hydroxy-7-(3-oxo-3-propoxypropanoyl)oxydodecanoyl]oxymethyl] 1-O-propyl propanedioate is CCCCCC(OC(=O)CC(=O)OCCC)C(O)CCCCC(=O)OCOC(=O)CC(=O)OCCC.
What is the InChIKey of 3-O-[[6-hydroxy-7-(3-oxo-3-propoxypropanoyl)oxydodecanoyl]oxymethyl] 1-O-propyl propanedioate?
The InChIKey is DTFZQCNJXZYFHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H42O11/c1-4-7-8-12-20(36-25(31)17-23(29)33-15-6-3)19(26)11-9-10-13-21(27)34-18-35-24(30)16-22(28)32-14-5-2/h19-20,26H,4-18H2,1-3H3.
What are the key properties of 3-O-[[6-hydroxy-7-(3-oxo-3-propoxypropanoyl)oxydodecanoyl]oxymethyl] 1-O-propyl propanedioate?
3-O-[[6-hydroxy-7-(3-oxo-3-propoxypropanoyl)oxydodecanoyl]oxymethyl] 1-O-propyl propanedioate has a molecular weight of 518.60 g/mol, XLogP of 3.13, 21 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-[[6-hydroxy-7-(3-oxo-3-propoxypropanoyl)oxydodecanoyl]oxymethyl] 1-O-propyl propanedioate is sourced from PubChem (CID 118013041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).