About 3-hydroxypropyl 9-hydroxy-10-(3-hydroxypropoxy)octadecanoate
3-hydroxypropyl 9-hydroxy-10-(3-hydroxypropoxy)octadecanoate (PubChem CID 87106037) has the molecular formula C24H48O6
and a molecular weight of 432.64 g/mol. Its IUPAC name is 3-hydroxypropyl 9-hydroxy-10-(3-hydroxypropoxy)octadecanoate.
Molecular Properties
| Compound Name | 3-hydroxypropyl 9-hydroxy-10-(3-hydroxypropoxy)octadecanoate |
| PubChem CID | 87106037 |
| Molecular Formula | C24H48O6 |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | 3-hydroxypropyl 9-hydroxy-10-(3-hydroxypropoxy)octadecanoate |
| SMILES | CCCCCCCCC(OCCCO)C(O)CCCCCCCC(=O)OCCCO |
| InChI | InChI=1S/C24H48O6/c1-2-3-4-5-8-11-16-23(29-20-13-18-25)22(27)15-10-7-6-9-12-17-24(28)30-21-14-19-26/h22-23,25-27H,2-21H2,1H3 |
| InChIKey | ALLIQJKWSFIPFR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypropyl 9-hydroxy-10-(3-hydroxypropoxy)octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypropyl 9-hydroxy-10-(3-hydroxypropoxy)octadecanoate?
The IUPAC name of 3-hydroxypropyl 9-hydroxy-10-(3-hydroxypropoxy)octadecanoate (CID 87106037) is 3-hydroxypropyl 9-hydroxy-10-(3-hydroxypropoxy)octadecanoate.
What is the SMILES notation for 3-hydroxypropyl 9-hydroxy-10-(3-hydroxypropoxy)octadecanoate?
The canonical SMILES for 3-hydroxypropyl 9-hydroxy-10-(3-hydroxypropoxy)octadecanoate is CCCCCCCCC(OCCCO)C(O)CCCCCCCC(=O)OCCCO.
What is the InChIKey of 3-hydroxypropyl 9-hydroxy-10-(3-hydroxypropoxy)octadecanoate?
The InChIKey is ALLIQJKWSFIPFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H48O6/c1-2-3-4-5-8-11-16-23(29-20-13-18-25)22(27)15-10-7-6-9-12-17-24(28)30-21-14-19-26/h22-23,25-27H,2-21H2,1H3.
What are the key properties of 3-hydroxypropyl 9-hydroxy-10-(3-hydroxypropoxy)octadecanoate?
3-hydroxypropyl 9-hydroxy-10-(3-hydroxypropoxy)octadecanoate has a molecular weight of 432.64 g/mol, XLogP of 4.52, 23 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypropyl 9-hydroxy-10-(3-hydroxypropoxy)octadecanoate is sourced from PubChem (CID 87106037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).