About 4-hydroxybutyl 9-ethoxy-10-hydroxyoctadecanoate;yttrium
4-hydroxybutyl 9-ethoxy-10-hydroxyoctadecanoate;yttrium (PubChem CID 140603563) has the molecular formula C24H48O5Y
and a molecular weight of 505.55 g/mol. Its IUPAC name is 4-hydroxybutyl 9-ethoxy-10-hydroxyoctadecanoate;yttrium.
Molecular Properties
| Compound Name | 4-hydroxybutyl 9-ethoxy-10-hydroxyoctadecanoate;yttrium |
| PubChem CID | 140603563 |
| Molecular Formula | C24H48O5Y |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 4-hydroxybutyl 9-ethoxy-10-hydroxyoctadecanoate;yttrium |
| SMILES | CCCCCCCCC(O)C(CCCCCCCC(=O)OCCCCO)OCC.[Y] |
| InChI | InChI=1S/C24H48O5.Y/c1-3-5-6-7-9-12-17-22(26)23(28-4-2)18-13-10-8-11-14-19-24(27)29-21-16-15-20-25;/h22-23,25-26H,3-21H2,1-2H3; |
| InChIKey | BBSZQEDOZNXBGN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybutyl 9-ethoxy-10-hydroxyoctadecanoate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybutyl 9-ethoxy-10-hydroxyoctadecanoate;yttrium?
The IUPAC name of 4-hydroxybutyl 9-ethoxy-10-hydroxyoctadecanoate;yttrium (CID 140603563) is 4-hydroxybutyl 9-ethoxy-10-hydroxyoctadecanoate;yttrium.
What is the SMILES notation for 4-hydroxybutyl 9-ethoxy-10-hydroxyoctadecanoate;yttrium?
The canonical SMILES for 4-hydroxybutyl 9-ethoxy-10-hydroxyoctadecanoate;yttrium is CCCCCCCCC(O)C(CCCCCCCC(=O)OCCCCO)OCC.[Y].
What is the InChIKey of 4-hydroxybutyl 9-ethoxy-10-hydroxyoctadecanoate;yttrium?
The InChIKey is BBSZQEDOZNXBGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H48O5.Y/c1-3-5-6-7-9-12-17-22(26)23(28-4-2)18-13-10-8-11-14-19-24(27)29-21-16-15-20-25;/h22-23,25-26H,3-21H2,1-2H3;.
What are the key properties of 4-hydroxybutyl 9-ethoxy-10-hydroxyoctadecanoate;yttrium?
4-hydroxybutyl 9-ethoxy-10-hydroxyoctadecanoate;yttrium has a molecular weight of 505.55 g/mol, XLogP of 5.55, 22 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybutyl 9-ethoxy-10-hydroxyoctadecanoate;yttrium is sourced from PubChem (CID 140603563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).