C22H44O7 — CID 121278723
2-hydroxyethyl 9,12-dihydroxy-10,13-dimethoxyoctadecanoate (PubChem CID 121278723) has the molecular formula C22H44O7 and a molecular weight of 420.59 g/mol. Its IUPAC name is 2-hydroxyethyl 9,12-dihydroxy-10,13-dimethoxyoctadecanoate.
| Compound Name | 2-hydroxyethyl 9,12-dihydroxy-10,13-dimethoxyoctadecanoate |
|---|---|
| PubChem CID | 121278723 |
| Molecular Formula | C22H44O7 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | 2-hydroxyethyl 9,12-dihydroxy-10,13-dimethoxyoctadecanoate |
| SMILES | CCCCCC(OC)C(O)CC(OC)C(O)CCCCCCCC(=O)OCCO |
| InChI | InChI=1S/C22H44O7/c1-4-5-9-13-20(27-2)19(25)17-21(28-3)18(24)12-10-7-6-8-11-14-22(26)29-16-15-23/h18-21,23-25H,4-17H2,1-3H3 |
| InChIKey | AELSARTWKVBHCI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|