C29H42FNO5 — CID 118032814
methyl 3-(4-fluorophenyl)-8-[2-[(Z,6S,7S)-7-hydroxydodec-3-en-6-yl]oxy-2-oxoethyl]-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 118032814) has the molecular formula C29H42FNO5 and a molecular weight of 503.66 g/mol. Its IUPAC name is methyl 3-(4-fluorophenyl)-8-[2-[(Z,6S,7S)-7-hydroxydodec-3-en-6-yl]oxy-2-oxoethyl]-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl 3-(4-fluorophenyl)-8-[2-[(Z,6S,7S)-7-hydroxydodec-3-en-6-yl]oxy-2-oxoethyl]-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 118032814 |
| Molecular Formula | C29H42FNO5 |
| Molecular Weight | 503.66 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | methyl 3-(4-fluorophenyl)-8-[2-[(Z,6S,7S)-7-hydroxydodec-3-en-6-yl]oxy-2-oxoethyl]-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | CC/C=C\C[C@H](OC(=O)CN1C2CCC1C(C(=O)OC)C(c1ccc(F)cc1)C2)[C@@H](O)CCCCC |
| InChI | InChI=1S/C29H42FNO5/c1-4-6-8-10-25(32)26(11-9-7-5-2)36-27(33)19-31-22-16-17-24(31)28(29(34)35-3)23(18-22)20-12-14-21(30)15-13-20/h7,9,12-15,22-26,28,32H,4-6,8,10-11,16-19H2,1-3H3/b9-7-/t22?,23?,24?,25-,26-,28?/m0/s1 |
| InChIKey | IZEVFZDJUPMMGJ-ZMPKPYDNSA-N |
| XLogP | 5.14 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|