C25H25ClN6O — CID 118034014
cis-(1S,3R)-N-(4-aminophenyl)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexane-1-carboxamide (PubChem CID 118034014) has the molecular formula C25H25ClN6O and a molecular weight of 460.97 g/mol. Its IUPAC name is cis-(1S,3R)-N-(4-aminophenyl)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexane-1-carboxamide.
| Compound Name | cis-(1S,3R)-N-(4-aminophenyl)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118034014 |
| Molecular Formula | C25H25ClN6O |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | cis-(1S,3R)-N-(4-aminophenyl)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexane-1-carboxamide |
| SMILES | Nc1ccc(NC(=O)[C@H]2CCC[C@@H](Nc3ncc(Cl)c(-c4c[nH]c5ccccc45)n3)C2)cc1 |
| InChI | InChI=1S/C25H25ClN6O/c26-21-14-29-25(32-23(21)20-13-28-22-7-2-1-6-19(20)22)31-18-5-3-4-15(12-18)24(33)30-17-10-8-16(27)9-11-17/h1-2,6-11,13-15,18,28H,3-5,12,27H2,(H,30,33)(H,29,31,32)/t15-,18+/m0/s1 |
| InChIKey | YZZPOUOKOSXKME-MAUKXSAKSA-N |
| XLogP | 5.47 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|