C18H23ClN4O2S — CID 118034755
N'-[6-[(3-chlorophenyl)methylsulfonyl-methylamino]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 118034755) has the molecular formula C18H23ClN4O2S and a molecular weight of 394.93 g/mol. Its IUPAC name is N'-[6-[(3-chlorophenyl)methylsulfonyl-methylamino]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[6-[(3-chlorophenyl)methylsulfonyl-methylamino]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 118034755 |
| Molecular Formula | C18H23ClN4O2S |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N'-[6-[(3-chlorophenyl)methylsulfonyl-methylamino]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1ccc(N(C)S(=O)(=O)Cc2cccc(Cl)c2)nc1C |
| InChI | InChI=1S/C18H23ClN4O2S/c1-5-22(3)13-20-17-9-10-18(21-14(17)2)23(4)26(24,25)12-15-7-6-8-16(19)11-15/h6-11,13H,5,12H2,1-4H3/b20-13+ |
| InChIKey | JZFCFHFZVPIRNK-DEDYPNTBSA-N |
| XLogP | 3.62 |
| TPSA | 65.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|