C24H21ClN4O4 — CID 118035177
4H-pyrimidin-3-ylmethyl 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoate (PubChem CID 118035177) has the molecular formula C24H21ClN4O4 and a molecular weight of 464.91 g/mol. Its IUPAC name is 4H-pyrimidin-3-ylmethyl 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoate.
| Compound Name | 4H-pyrimidin-3-ylmethyl 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoate |
|---|---|
| PubChem CID | 118035177 |
| Molecular Formula | C24H21ClN4O4 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 4H-pyrimidin-3-ylmethyl 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoate |
| SMILES | O=C(NC(Cc1cc(=O)[nH]c2ccccc12)C(=O)OCN1C=NC=CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H21ClN4O4/c25-18-8-6-16(7-9-18)23(31)28-21(24(32)33-15-29-11-3-10-26-14-29)12-17-13-22(30)27-20-5-2-1-4-19(17)20/h1-10,13-14,21H,11-12,15H2,(H,27,30)(H,28,31) |
| InChIKey | GFLLZCAHNGRGPF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |