C27H23ClN2O4 — CID 118035165
(3-methylphenyl)methyl 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoate (PubChem CID 118035165) has the molecular formula C27H23ClN2O4 and a molecular weight of 474.94 g/mol. Its IUPAC name is (3-methylphenyl)methyl 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoate.
| Compound Name | (3-methylphenyl)methyl 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoate |
|---|---|
| PubChem CID | 118035165 |
| Molecular Formula | C27H23ClN2O4 |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | (3-methylphenyl)methyl 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoate |
| SMILES | Cc1cccc(COC(=O)C(Cc2cc(=O)[nH]c3ccccc23)NC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C27H23ClN2O4/c1-17-5-4-6-18(13-17)16-34-27(33)24(30-26(32)19-9-11-21(28)12-10-19)14-20-15-25(31)29-23-8-3-2-7-22(20)23/h2-13,15,24H,14,16H2,1H3,(H,29,31)(H,30,32) |
| InChIKey | SLSYJAZOHKVNHB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |