C27H23ClN2O3S — CID 118035487
S-(2-phenylethyl) 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate (PubChem CID 118035487) has the molecular formula C27H23ClN2O3S and a molecular weight of 491.01 g/mol. Its IUPAC name is S-(2-phenylethyl) 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate.
| Compound Name | S-(2-phenylethyl) 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate |
|---|---|
| PubChem CID | 118035487 |
| Molecular Formula | C27H23ClN2O3S |
| Molecular Weight | 491.01 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | S-(2-phenylethyl) 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate |
| SMILES | O=C(NC(Cc1cc(=O)[nH]c2ccccc12)C(=O)SCCc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H23ClN2O3S/c28-21-12-10-19(11-13-21)26(32)30-24(27(33)34-15-14-18-6-2-1-3-7-18)16-20-17-25(31)29-23-9-5-4-8-22(20)23/h1-13,17,24H,14-16H2,(H,29,31)(H,30,32) |
| InChIKey | NWFUCXIFLDHRGX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.01 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|