C23H22ClN3O5 — CID 41129627
4-[[(2R)-2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoyl]amino]butanoic acid (PubChem CID 41129627) has the molecular formula C23H22ClN3O5 and a molecular weight of 455.90 g/mol. Its IUPAC name is 4-[[(2R)-2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoyl]amino]butanoic acid.
| Compound Name | 4-[[(2R)-2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 41129627 |
| Molecular Formula | C23H22ClN3O5 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 4-[[(2R)-2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)[C@@H](Cc1cc(=O)[nH]c2ccccc12)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22ClN3O5/c24-16-9-7-14(8-10-16)22(31)27-19(23(32)25-11-3-6-21(29)30)12-15-13-20(28)26-18-5-2-1-4-17(15)18/h1-2,4-5,7-10,13,19H,3,6,11-12H2,(H,25,32)(H,26,28)(H,27,31)(H,29,30)/t19-/m1/s1 |
| InChIKey | PMKAPTNCWUZITM-LJQANCHMSA-N |
| XLogP | 2.50 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|