About S-[2-(azepan-2-yl)ethyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate
S-[2-(azepan-2-yl)ethyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate (PubChem CID 141396614) has the molecular formula C27H30ClN3O3S
and a molecular weight of 512.08 g/mol. Its IUPAC name is S-[2-(azepan-2-yl)ethyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate.
Molecular Properties
| Compound Name | S-[2-(azepan-2-yl)ethyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate |
| PubChem CID | 141396614 |
| Molecular Formula | C27H30ClN3O3S |
| Molecular Weight | 512.08 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | S-[2-(azepan-2-yl)ethyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate |
| SMILES | O=C(NC(Cc1cc(=O)[nH]c2ccccc12)C(=O)SCCC1CCCCCN1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H30ClN3O3S/c28-20-11-9-18(10-12-20)26(33)31-24(27(34)35-15-13-21-6-2-1-5-14-29-21)16-19-17-25(32)30-23-8-4-3-7-22(19)23/h3-4,7-12,17,21,24,29H,1-2,5-6,13-16H2,(H,30,32)(H,31,33) |
| InChIKey | QUOHHSTVIYQUSU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 512.08 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-(azepan-2-yl)ethyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-(azepan-2-yl)ethyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate?
The IUPAC name of S-[2-(azepan-2-yl)ethyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate (CID 141396614) is S-[2-(azepan-2-yl)ethyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate.
What is the SMILES notation for S-[2-(azepan-2-yl)ethyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate?
The canonical SMILES for S-[2-(azepan-2-yl)ethyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate is O=C(NC(Cc1cc(=O)[nH]c2ccccc12)C(=O)SCCC1CCCCCN1)c1ccc(Cl)cc1.
What is the InChIKey of S-[2-(azepan-2-yl)ethyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate?
The InChIKey is QUOHHSTVIYQUSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30ClN3O3S/c28-20-11-9-18(10-12-20)26(33)31-24(27(34)35-15-13-21-6-2-1-5-14-29-21)16-19-17-25(32)30-23-8-4-3-7-22(19)23/h3-4,7-12,17,21,24,29H,1-2,5-6,13-16H2,(H,30,32)(H,31,33).
What are the key properties of S-[2-(azepan-2-yl)ethyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate?
S-[2-(azepan-2-yl)ethyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate has a molecular weight of 512.08 g/mol, XLogP of 4.70, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-(azepan-2-yl)ethyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate is sourced from PubChem (CID 141396614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).