C26H19Br2ClN2O3S — CID 118035566
S-[(3,5-dibromophenyl)methyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate (PubChem CID 118035566) has the molecular formula C26H19Br2ClN2O3S and a molecular weight of 634.78 g/mol. Its IUPAC name is S-[(3,5-dibromophenyl)methyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate.
| Compound Name | S-[(3,5-dibromophenyl)methyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate |
|---|---|
| PubChem CID | 118035566 |
| Molecular Formula | C26H19Br2ClN2O3S |
| Molecular Weight | 634.78 g/mol |
| Exact Mass | 631.92 |
| IUPAC Name | S-[(3,5-dibromophenyl)methyl] 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanethioate |
| SMILES | O=C(NC(Cc1cc(=O)[nH]c2ccccc12)C(=O)SCc1cc(Br)cc(Br)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H19Br2ClN2O3S/c27-18-9-15(10-19(28)13-18)14-35-26(34)23(31-25(33)16-5-7-20(29)8-6-16)11-17-12-24(32)30-22-4-2-1-3-21(17)22/h1-10,12-13,23H,11,14H2,(H,30,32)(H,31,33) |
| InChIKey | LXIBRGCQIVEXFH-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.78 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|