C26H20ClN3O6 — CID 118035098
(3-nitrophenyl)methyl 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoate (PubChem CID 118035098) has the molecular formula C26H20ClN3O6 and a molecular weight of 505.91 g/mol. Its IUPAC name is (3-nitrophenyl)methyl 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoate.
| Compound Name | (3-nitrophenyl)methyl 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoate |
|---|---|
| PubChem CID | 118035098 |
| Molecular Formula | C26H20ClN3O6 |
| Molecular Weight | 505.91 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | (3-nitrophenyl)methyl 2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoate |
| SMILES | O=C(NC(Cc1cc(=O)[nH]c2ccccc12)C(=O)OCc1cccc([N+](=O)[O-])c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H20ClN3O6/c27-19-10-8-17(9-11-19)25(32)29-23(13-18-14-24(31)28-22-7-2-1-6-21(18)22)26(33)36-15-16-4-3-5-20(12-16)30(34)35/h1-12,14,23H,13,15H2,(H,28,31)(H,29,32) |
| InChIKey | XCCHUCXWARLUGM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.91 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|