C18H26FN3O3 — CID 118035315
[(3aR,6aS)-5-[[2-[(2S,4S)-2-cyano-4-fluoropyrrolidin-1-yl]-2-oxoethyl]amino]-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl] acetate (PubChem CID 118035315) has the molecular formula C18H26FN3O3 and a molecular weight of 351.42 g/mol. Its IUPAC name is [(3aR,6aS)-5-[[2-[(2S,4S)-2-cyano-4-fluoropyrrolidin-1-yl]-2-oxoethyl]amino]-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl] acetate.
| Compound Name | [(3aR,6aS)-5-[[2-[(2S,4S)-2-cyano-4-fluoropyrrolidin-1-yl]-2-oxoethyl]amino]-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl] acetate |
|---|---|
| PubChem CID | 118035315 |
| Molecular Formula | C18H26FN3O3 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | [(3aR,6aS)-5-[[2-[(2S,4S)-2-cyano-4-fluoropyrrolidin-1-yl]-2-oxoethyl]amino]-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl] acetate |
| SMILES | CC(=O)OC1C[C@@H]2CC(C)(NCC(=O)N3C[C@@H](F)C[C@H]3C#N)C[C@@H]2C1 |
| InChI | InChI=1S/C18H26FN3O3/c1-11(23)25-16-3-12-6-18(2,7-13(12)4-16)21-9-17(24)22-10-14(19)5-15(22)8-20/h12-16,21H,3-7,9-10H2,1-2H3/t12-,13+,14-,15-,16?,18?/m0/s1 |
| InChIKey | NEHAAVHGSTYQLW-UZLYDHHDSA-N |
| XLogP | 1.55 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |