C17H27FN4O — CID 126576787
(2S,4S)-1-[2-[[(3aR,6aS)-5-(aminomethyl)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl]amino]acetyl]-4-fluoropyrrolidine-2-carbonitrile (PubChem CID 126576787) has the molecular formula C17H27FN4O and a molecular weight of 322.43 g/mol. Its IUPAC name is (2S,4S)-1-[2-[[(3aR,6aS)-5-(aminomethyl)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl]amino]acetyl]-4-fluoropyrrolidine-2-carbonitrile.
| Compound Name | (2S,4S)-1-[2-[[(3aR,6aS)-5-(aminomethyl)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl]amino]acetyl]-4-fluoropyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 126576787 |
| Molecular Formula | C17H27FN4O |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | (2S,4S)-1-[2-[[(3aR,6aS)-5-(aminomethyl)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl]amino]acetyl]-4-fluoropyrrolidine-2-carbonitrile |
| SMILES | CC1(NCC(=O)N2C[C@@H](F)C[C@H]2C#N)C[C@H]2CC(CN)C[C@H]2C1 |
| InChI | InChI=1S/C17H27FN4O/c1-17(5-12-2-11(7-19)3-13(12)6-17)21-9-16(23)22-10-14(18)4-15(22)8-20/h11-15,21H,2-7,9-10,19H2,1H3/t11?,12-,13+,14-,15-,17?/m0/s1 |
| InChIKey | YASVHOVWIKYRIR-MGHDBASKSA-N |
| XLogP | 1.19 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |