About trans-2-ethoxyethyl (1R,2R)-2-methylcyclopropane-1-carboxylate
trans-2-ethoxyethyl (1R,2R)-2-methylcyclopropane-1-carboxylate (PubChem CID 118035836) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is trans-2-ethoxyethyl (1R,2R)-2-methylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | trans-2-ethoxyethyl (1R,2R)-2-methylcyclopropane-1-carboxylate |
| PubChem CID | 118035836 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | trans-2-ethoxyethyl (1R,2R)-2-methylcyclopropane-1-carboxylate |
| SMILES | CCOCCOC(=O)[C@@H]1C[C@H]1C |
| InChI | InChI=1S/C9H16O3/c1-3-11-4-5-12-9(10)8-6-7(8)2/h7-8H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | PPOQEYOJAKMDBV-HTQZYQBOSA-N |
| XLogP | 1.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze trans-2-ethoxyethyl (1R,2R)-2-methylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-2-ethoxyethyl (1R,2R)-2-methylcyclopropane-1-carboxylate?
The IUPAC name of trans-2-ethoxyethyl (1R,2R)-2-methylcyclopropane-1-carboxylate (CID 118035836) is trans-2-ethoxyethyl (1R,2R)-2-methylcyclopropane-1-carboxylate.
What is the SMILES notation for trans-2-ethoxyethyl (1R,2R)-2-methylcyclopropane-1-carboxylate?
The canonical SMILES for trans-2-ethoxyethyl (1R,2R)-2-methylcyclopropane-1-carboxylate is CCOCCOC(=O)[C@@H]1C[C@H]1C.
What is the InChIKey of trans-2-ethoxyethyl (1R,2R)-2-methylcyclopropane-1-carboxylate?
The InChIKey is PPOQEYOJAKMDBV-HTQZYQBOSA-N. The full InChI is InChI=1S/C9H16O3/c1-3-11-4-5-12-9(10)8-6-7(8)2/h7-8H,3-6H2,1-2H3/t7-,8-/m1/s1.
What are the key properties of trans-2-ethoxyethyl (1R,2R)-2-methylcyclopropane-1-carboxylate?
trans-2-ethoxyethyl (1R,2R)-2-methylcyclopropane-1-carboxylate has a molecular weight of 172.22 g/mol, XLogP of 1.22, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-2-ethoxyethyl (1R,2R)-2-methylcyclopropane-1-carboxylate is sourced from PubChem (CID 118035836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).