C8H10BrN3O2 — CID 118036259
5-bromo-4-[(3S)-oxolan-3-yl]oxypyrimidin-2-amine (PubChem CID 118036259) has the molecular formula C8H10BrN3O2 and a molecular weight of 260.09 g/mol. Its IUPAC name is 5-bromo-4-[(3S)-oxolan-3-yl]oxypyrimidin-2-amine.
| Compound Name | 5-bromo-4-[(3S)-oxolan-3-yl]oxypyrimidin-2-amine |
|---|---|
| PubChem CID | 118036259 |
| Molecular Formula | C8H10BrN3O2 |
| Molecular Weight | 260.09 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 5-bromo-4-[(3S)-oxolan-3-yl]oxypyrimidin-2-amine |
| SMILES | Nc1ncc(Br)c(O[C@H]2CCOC2)n1 |
| InChI | InChI=1S/C8H10BrN3O2/c9-6-3-11-8(10)12-7(6)14-5-1-2-13-4-5/h3,5H,1-2,4H2,(H2,10,11,12)/t5-/m0/s1 |
| InChIKey | BRGLPQOKZAJJEP-YFKPBYRVSA-N |
| XLogP | 0.99 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.09 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |