C9H10N4O2 — CID 118036555
2-amino-4-[(3S)-oxolan-3-yl]oxypyrimidine-5-carbonitrile (PubChem CID 118036555) has the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. Its IUPAC name is 2-amino-4-[(3S)-oxolan-3-yl]oxypyrimidine-5-carbonitrile.
| Compound Name | 2-amino-4-[(3S)-oxolan-3-yl]oxypyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 118036555 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2-amino-4-[(3S)-oxolan-3-yl]oxypyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(N)nc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C9H10N4O2/c10-3-6-4-12-9(11)13-8(6)15-7-1-2-14-5-7/h4,7H,1-2,5H2,(H2,11,12,13)/t7-/m0/s1 |
| InChIKey | DYBBGZCJHXJEFY-ZETCQYMHSA-N |
| XLogP | 0.10 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |