C24H29N7O4 — CID 118036773
6-[[acetyl(ethyl)amino]methyl]-N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 118036773) has the molecular formula C24H29N7O4 and a molecular weight of 479.54 g/mol. Its IUPAC name is 6-[[acetyl(ethyl)amino]methyl]-N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | 6-[[acetyl(ethyl)amino]methyl]-N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 118036773 |
| Molecular Formula | C24H29N7O4 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 6-[[acetyl(ethyl)amino]methyl]-N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | CCN(Cc1cc2c(nc1C=O)N(C(=O)Nc1cc(NCCOC)c(C#N)cn1)CCC2)C(C)=O |
| InChI | InChI=1S/C24H29N7O4/c1-4-30(16(2)33)14-18-10-17-6-5-8-31(23(17)28-21(18)15-32)24(34)29-22-11-20(26-7-9-35-3)19(12-25)13-27-22/h10-11,13,15H,4-9,14H2,1-3H3,(H2,26,27,29,34) |
| InChIKey | LYVKHZZBBRVBSG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|