C20H28ClN3O2 — CID 118037670
[(3R)-3-[[2-chloro-5-[(E,4S)-4-(methylamino)pent-1-enyl]-3-pyridinyl]oxy]pyrrolidin-1-yl]-cyclobutylmethanone (PubChem CID 118037670) has the molecular formula C20H28ClN3O2 and a molecular weight of 377.92 g/mol. Its IUPAC name is [(3R)-3-[[2-chloro-5-[(E,4S)-4-(methylamino)pent-1-enyl]-3-pyridinyl]oxy]pyrrolidin-1-yl]-cyclobutylmethanone.
| Compound Name | [(3R)-3-[[2-chloro-5-[(E,4S)-4-(methylamino)pent-1-enyl]-3-pyridinyl]oxy]pyrrolidin-1-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 118037670 |
| Molecular Formula | C20H28ClN3O2 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | [(3R)-3-[[2-chloro-5-[(E,4S)-4-(methylamino)pent-1-enyl]-3-pyridinyl]oxy]pyrrolidin-1-yl]-cyclobutylmethanone |
| SMILES | CN[C@@H](C)C/C=C/c1cnc(Cl)c(O[C@@H]2CCN(C(=O)C3CCC3)C2)c1 |
| InChI | InChI=1S/C20H28ClN3O2/c1-14(22-2)5-3-6-15-11-18(19(21)23-12-15)26-17-9-10-24(13-17)20(25)16-7-4-8-16/h3,6,11-12,14,16-17,22H,4-5,7-10,13H2,1-2H3/b6-3+/t14-,17+/m0/s1 |
| InChIKey | RZGCDGBAAWSTNK-ORCRKBFJSA-N |
| XLogP | 3.53 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|