C11H16N2O — CID 89322861
5-[(E,4S)-4-(methylamino)pent-1-enyl]pyridin-3-ol (PubChem CID 89322861) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 5-[(E,4S)-4-(methylamino)pent-1-enyl]pyridin-3-ol.
| Compound Name | 5-[(E,4S)-4-(methylamino)pent-1-enyl]pyridin-3-ol |
|---|---|
| PubChem CID | 89322861 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 5-[(E,4S)-4-(methylamino)pent-1-enyl]pyridin-3-ol |
| SMILES | CN[C@@H](C)C/C=C/c1cncc(O)c1 |
| InChI | InChI=1S/C11H16N2O/c1-9(12-2)4-3-5-10-6-11(14)8-13-7-10/h3,5-9,12,14H,4H2,1-2H3/b5-3+/t9-/m0/s1 |
| InChIKey | UVSVAXFPUOHHQV-SGRBOOSSSA-N |
| XLogP | 1.80 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |