C22H27N6O4+ — CID 118038401
1-[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]-6-[(dimethylamino)methyl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide (PubChem CID 118038401) has the molecular formula C22H27N6O4+ and a molecular weight of 439.50 g/mol. Its IUPAC name is 1-[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]-6-[(dimethylamino)methyl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide.
| Compound Name | 1-[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]-6-[(dimethylamino)methyl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 118038401 |
| Molecular Formula | C22H27N6O4+ |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 1-[5-cyano-4-(2-methoxyethoxy)-2-pyridinyl]-6-[(dimethylamino)methyl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide |
| SMILES | COCCOc1cc([N+]2(C(N)=O)CCCc3cc(CN(C)C)c(C=O)nc32)ncc1C#N |
| InChI | InChI=1S/C22H26N6O4/c1-27(2)13-16-9-15-5-4-6-28(22(24)30,21(15)26-18(16)14-29)20-10-19(32-8-7-31-3)17(11-23)12-25-20/h9-10,12,14H,4-8,13H2,1-3H3,(H-,24,30)/p+1 |
| InChIKey | WTJORPMICMKXAB-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 131.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|