C16H11N4+ — CID 118041546
2-azidoethyl-dodeca-1,3,5,7,9,11-hexaynyl-dimethylazanium (PubChem CID 118041546) has the molecular formula C16H11N4+ and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-azidoethyl-dodeca-1,3,5,7,9,11-hexaynyl-dimethylazanium.
| Compound Name | 2-azidoethyl-dodeca-1,3,5,7,9,11-hexaynyl-dimethylazanium |
|---|---|
| PubChem CID | 118041546 |
| Molecular Formula | C16H11N4+ |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-azidoethyl-dodeca-1,3,5,7,9,11-hexaynyl-dimethylazanium |
| SMILES | C#CC#CC#CC#CC#CC#C[N+](C)(C)CCN=[N+]=[N-] |
| InChI | InChI=1S/C16H11N4/c1-4-5-6-7-8-9-10-11-12-13-15-20(2,3)16-14-18-19-17/h1H,14,16H2,2-3H3/q+1 |
| InChIKey | GAOJHXHAQLQANZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|