C12H22O2 — CID 118042032
methyl 2-[3-tert-butyl-2-methyl-2-(trideuteriomethyl)cyclopropyl]acetate (PubChem CID 118042032) has the molecular formula C12H22O2 and a molecular weight of 201.32 g/mol. Its IUPAC name is methyl 2-[3-tert-butyl-2-methyl-2-(trideuteriomethyl)cyclopropyl]acetate.
| Compound Name | methyl 2-[3-tert-butyl-2-methyl-2-(trideuteriomethyl)cyclopropyl]acetate |
|---|---|
| PubChem CID | 118042032 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 201.32 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | methyl 2-[3-tert-butyl-2-methyl-2-(trideuteriomethyl)cyclopropyl]acetate |
| SMILES | [2H]C([2H])([2H])C1(C)C(CC(=O)OC)C1C(C)(C)C |
| InChI | InChI=1S/C12H22O2/c1-11(2,3)10-8(12(10,4)5)7-9(13)14-6/h8,10H,7H2,1-6H3/i4D3 |
| InChIKey | PBFRLQWYDXDXMW-GKOSEXJESA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |