C11H18O3 — CID 88797661
methyl 2-[2,2-dimethyl-3-(3-oxopropyl)cyclopropyl]acetate (PubChem CID 88797661) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is methyl 2-[2,2-dimethyl-3-(3-oxopropyl)cyclopropyl]acetate.
| Compound Name | methyl 2-[2,2-dimethyl-3-(3-oxopropyl)cyclopropyl]acetate |
|---|---|
| PubChem CID | 88797661 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | methyl 2-[2,2-dimethyl-3-(3-oxopropyl)cyclopropyl]acetate |
| SMILES | COC(=O)CC1C(CCC=O)C1(C)C |
| InChI | InChI=1S/C11H18O3/c1-11(2)8(5-4-6-12)9(11)7-10(13)14-3/h6,8-9H,4-5,7H2,1-3H3 |
| InChIKey | SVNZNHZRPSGOCR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|