C19H31N3 — CID 118042391
N-benzyl-N-methyl-1-[(3S)-3-(4-methylpiperazin-1-yl)cyclopentyl]methanamine (PubChem CID 118042391) has the molecular formula C19H31N3 and a molecular weight of 301.48 g/mol. Its IUPAC name is N-benzyl-N-methyl-1-[(3S)-3-(4-methylpiperazin-1-yl)cyclopentyl]methanamine.
| Compound Name | N-benzyl-N-methyl-1-[(3S)-3-(4-methylpiperazin-1-yl)cyclopentyl]methanamine |
|---|---|
| PubChem CID | 118042391 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | N-benzyl-N-methyl-1-[(3S)-3-(4-methylpiperazin-1-yl)cyclopentyl]methanamine |
| SMILES | CN1CCN([C@H]2CCC(CN(C)Cc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C19H31N3/c1-20-10-12-22(13-11-20)19-9-8-18(14-19)16-21(2)15-17-6-4-3-5-7-17/h3-7,18-19H,8-16H2,1-2H3/t18?,19-/m0/s1 |
| InChIKey | ICYDGHOKWPYNLK-GGYWPGCISA-N |
| XLogP | 2.53 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |