C17H15BrClN3O2S — CID 118043026
6-bromo-3-(5-chloro-2-ethylsulfinylanilino)-7-methylquinazolin-4-one (PubChem CID 118043026) has the molecular formula C17H15BrClN3O2S and a molecular weight of 440.75 g/mol. Its IUPAC name is 6-bromo-3-(5-chloro-2-ethylsulfinylanilino)-7-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-(5-chloro-2-ethylsulfinylanilino)-7-methylquinazolin-4-one |
|---|---|
| PubChem CID | 118043026 |
| Molecular Formula | C17H15BrClN3O2S |
| Molecular Weight | 440.75 g/mol |
| Exact Mass | 438.98 |
| IUPAC Name | 6-bromo-3-(5-chloro-2-ethylsulfinylanilino)-7-methylquinazolin-4-one |
| SMILES | CCS(=O)c1ccc(Cl)cc1Nn1cnc2cc(C)c(Br)cc2c1=O |
| InChI | InChI=1S/C17H15BrClN3O2S/c1-3-25(24)16-5-4-11(19)7-15(16)21-22-9-20-14-6-10(2)13(18)8-12(14)17(22)23/h4-9,21H,3H2,1-2H3 |
| InChIKey | YFSBPIJFGZZBAD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.75 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |