C22H25BrClN5O2S2 — CID 144834082
6-bromo-3-(5-chloro-2-ethylsulfinylanilino)-7-[(4-methylsulfanylpiperazin-1-yl)methyl]quinazolin-4-one (PubChem CID 144834082) has the molecular formula C22H25BrClN5O2S2 and a molecular weight of 570.97 g/mol. Its IUPAC name is 6-bromo-3-(5-chloro-2-ethylsulfinylanilino)-7-[(4-methylsulfanylpiperazin-1-yl)methyl]quinazolin-4-one.
| Compound Name | 6-bromo-3-(5-chloro-2-ethylsulfinylanilino)-7-[(4-methylsulfanylpiperazin-1-yl)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 144834082 |
| Molecular Formula | C22H25BrClN5O2S2 |
| Molecular Weight | 570.97 g/mol |
| Exact Mass | 569.03 |
| IUPAC Name | 6-bromo-3-(5-chloro-2-ethylsulfinylanilino)-7-[(4-methylsulfanylpiperazin-1-yl)methyl]quinazolin-4-one |
| SMILES | CCS(=O)c1ccc(Cl)cc1Nn1cnc2cc(CN3CCN(SC)CC3)c(Br)cc2c1=O |
| InChI | InChI=1S/C22H25BrClN5O2S2/c1-3-33(31)21-5-4-16(24)11-20(21)26-29-14-25-19-10-15(18(23)12-17(19)22(29)30)13-27-6-8-28(32-2)9-7-27/h4-5,10-12,14,26H,3,6-9,13H2,1-2H3 |
| InChIKey | BMUNEJXAUXAELI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.97 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|