C19H15ClF3NO4S — CID 118043062
2-[(5-chloro-2-ethylsulfonylphenyl)methyl]-7-(trifluoromethoxy)isoquinolin-1-one (PubChem CID 118043062) has the molecular formula C19H15ClF3NO4S and a molecular weight of 445.85 g/mol. Its IUPAC name is 2-[(5-chloro-2-ethylsulfonylphenyl)methyl]-7-(trifluoromethoxy)isoquinolin-1-one.
| Compound Name | 2-[(5-chloro-2-ethylsulfonylphenyl)methyl]-7-(trifluoromethoxy)isoquinolin-1-one |
|---|---|
| PubChem CID | 118043062 |
| Molecular Formula | C19H15ClF3NO4S |
| Molecular Weight | 445.85 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 2-[(5-chloro-2-ethylsulfonylphenyl)methyl]-7-(trifluoromethoxy)isoquinolin-1-one |
| SMILES | CCS(=O)(=O)c1ccc(Cl)cc1Cn1ccc2ccc(OC(F)(F)F)cc2c1=O |
| InChI | InChI=1S/C19H15ClF3NO4S/c1-2-29(26,27)17-6-4-14(20)9-13(17)11-24-8-7-12-3-5-15(28-19(21,22)23)10-16(12)18(24)25/h3-10H,2,11H2,1H3 |
| InChIKey | QXMHRVUVPBVXJH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |