C23H24N4O3 — CID 118045784
4-[3-amino-6-[(3R)-oxolan-3-yl]pyrazin-2-yl]-N-[(1S)-2-hydroxy-1-phenylethyl]benzamide (PubChem CID 118045784) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-[3-amino-6-[(3R)-oxolan-3-yl]pyrazin-2-yl]-N-[(1S)-2-hydroxy-1-phenylethyl]benzamide.
| Compound Name | 4-[3-amino-6-[(3R)-oxolan-3-yl]pyrazin-2-yl]-N-[(1S)-2-hydroxy-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 118045784 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 4-[3-amino-6-[(3R)-oxolan-3-yl]pyrazin-2-yl]-N-[(1S)-2-hydroxy-1-phenylethyl]benzamide |
| SMILES | Nc1ncc([C@H]2CCOC2)nc1-c1ccc(C(=O)N[C@H](CO)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N4O3/c24-22-21(26-19(12-25-22)18-10-11-30-14-18)16-6-8-17(9-7-16)23(29)27-20(13-28)15-4-2-1-3-5-15/h1-9,12,18,20,28H,10-11,13-14H2,(H2,24,25)(H,27,29)/t18-,20+/m0/s1 |
| InChIKey | NNJVQVNAIFZJPS-AZUAARDMSA-N |
| XLogP | 2.69 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |