C25H29IN6O3 — CID 118047924
N-[2-[2-(4-ethyl-1-oxo-3H-2-benzofuran-5-yl)ethyl-(2-iodoethyl)amino]ethyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 118047924) has the molecular formula C25H29IN6O3 and a molecular weight of 588.45 g/mol. Its IUPAC name is N-[2-[2-(4-ethyl-1-oxo-3H-2-benzofuran-5-yl)ethyl-(2-iodoethyl)amino]ethyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | N-[2-[2-(4-ethyl-1-oxo-3H-2-benzofuran-5-yl)ethyl-(2-iodoethyl)amino]ethyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 118047924 |
| Molecular Formula | C25H29IN6O3 |
| Molecular Weight | 588.45 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | N-[2-[2-(4-ethyl-1-oxo-3H-2-benzofuran-5-yl)ethyl-(2-iodoethyl)amino]ethyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | CCc1c(CCN(CCI)CCNC(=O)Cc2ccc(-n3cnnn3)cc2)ccc2c1COC2=O |
| InChI | InChI=1S/C25H29IN6O3/c1-2-21-19(5-8-22-23(21)16-35-25(22)34)9-12-31(13-10-26)14-11-27-24(33)15-18-3-6-20(7-4-18)32-17-28-29-30-32/h3-8,17H,2,9-16H2,1H3,(H,27,33) |
| InChIKey | BZTKYSMTFVAKMC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|