C24H28N6O4 — CID 90247555
N-(3-hydroxypropyl)-N-[2-[2-(1-oxo-3H-2-benzofuran-5-yl)ethylamino]ethyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 90247555) has the molecular formula C24H28N6O4 and a molecular weight of 464.53 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-N-[2-[2-(1-oxo-3H-2-benzofuran-5-yl)ethylamino]ethyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | N-(3-hydroxypropyl)-N-[2-[2-(1-oxo-3H-2-benzofuran-5-yl)ethylamino]ethyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 90247555 |
| Molecular Formula | C24H28N6O4 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | N-(3-hydroxypropyl)-N-[2-[2-(1-oxo-3H-2-benzofuran-5-yl)ethylamino]ethyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | O=C1OCc2cc(CCNCCN(CCCO)C(=O)Cc3ccc(-n4cnnn4)cc3)ccc21 |
| InChI | InChI=1S/C24H28N6O4/c31-13-1-11-29(23(32)15-18-2-5-21(6-3-18)30-17-26-27-28-30)12-10-25-9-8-19-4-7-22-20(14-19)16-34-24(22)33/h2-7,14,17,25,31H,1,8-13,15-16H2 |
| InChIKey | YVSGULOEPBHUTP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|