C26H22BrN3O3 — CID 118053015
N-[7-bromo-4-oxo-3-[[(2S)-5-phenyloxolan-2-yl]methyl]quinazolin-2-yl]benzamide (PubChem CID 118053015) has the molecular formula C26H22BrN3O3 and a molecular weight of 504.38 g/mol. Its IUPAC name is N-[7-bromo-4-oxo-3-[[(2S)-5-phenyloxolan-2-yl]methyl]quinazolin-2-yl]benzamide.
| Compound Name | N-[7-bromo-4-oxo-3-[[(2S)-5-phenyloxolan-2-yl]methyl]quinazolin-2-yl]benzamide |
|---|---|
| PubChem CID | 118053015 |
| Molecular Formula | C26H22BrN3O3 |
| Molecular Weight | 504.38 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | N-[7-bromo-4-oxo-3-[[(2S)-5-phenyloxolan-2-yl]methyl]quinazolin-2-yl]benzamide |
| SMILES | O=C(Nc1nc2cc(Br)ccc2c(=O)n1C[C@@H]1CCC(c2ccccc2)O1)c1ccccc1 |
| InChI | InChI=1S/C26H22BrN3O3/c27-19-11-13-21-22(15-19)28-26(29-24(31)18-9-5-2-6-10-18)30(25(21)32)16-20-12-14-23(33-20)17-7-3-1-4-8-17/h1-11,13,15,20,23H,12,14,16H2,(H,28,29,31)/t20-,23?/m0/s1 |
| InChIKey | HWWSMHVVRITVNA-AJZOCDQUSA-N |
| XLogP | 5.33 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.38 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |