C38H31N3O4 — CID 118053184
N-[4-oxo-5-phenoxy-7-phenyl-3-[(5-phenyloxolan-2-yl)methyl]quinazolin-2-yl]benzamide (PubChem CID 118053184) has the molecular formula C38H31N3O4 and a molecular weight of 593.68 g/mol. Its IUPAC name is N-[4-oxo-5-phenoxy-7-phenyl-3-[(5-phenyloxolan-2-yl)methyl]quinazolin-2-yl]benzamide.
| Compound Name | N-[4-oxo-5-phenoxy-7-phenyl-3-[(5-phenyloxolan-2-yl)methyl]quinazolin-2-yl]benzamide |
|---|---|
| PubChem CID | 118053184 |
| Molecular Formula | C38H31N3O4 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | N-[4-oxo-5-phenoxy-7-phenyl-3-[(5-phenyloxolan-2-yl)methyl]quinazolin-2-yl]benzamide |
| SMILES | O=C(Nc1nc2cc(-c3ccccc3)cc(Oc3ccccc3)c2c(=O)n1CC1CCC(c2ccccc2)O1)c1ccccc1 |
| InChI | InChI=1S/C38H31N3O4/c42-36(28-17-9-3-10-18-28)40-38-39-32-23-29(26-13-5-1-6-14-26)24-34(44-30-19-11-4-12-20-30)35(32)37(43)41(38)25-31-21-22-33(45-31)27-15-7-2-8-16-27/h1-20,23-24,31,33H,21-22,25H2,(H,39,40,42) |
| InChIKey | YJSQKEWABPTYHE-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |