C22H28FN5O3 — CID 118053453
(E)-1-[(3S)-4-(4-amino-8-fluoro-6,7-dimethoxyquinazolin-2-yl)-3-methylpiperazin-1-yl]-3-cyclobutylprop-2-en-1-one (PubChem CID 118053453) has the molecular formula C22H28FN5O3 and a molecular weight of 429.50 g/mol. Its IUPAC name is (E)-1-[(3S)-4-(4-amino-8-fluoro-6,7-dimethoxyquinazolin-2-yl)-3-methylpiperazin-1-yl]-3-cyclobutylprop-2-en-1-one.
| Compound Name | (E)-1-[(3S)-4-(4-amino-8-fluoro-6,7-dimethoxyquinazolin-2-yl)-3-methylpiperazin-1-yl]-3-cyclobutylprop-2-en-1-one |
|---|---|
| PubChem CID | 118053453 |
| Molecular Formula | C22H28FN5O3 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (E)-1-[(3S)-4-(4-amino-8-fluoro-6,7-dimethoxyquinazolin-2-yl)-3-methylpiperazin-1-yl]-3-cyclobutylprop-2-en-1-one |
| SMILES | COc1cc2c(N)nc(N3CCN(C(=O)/C=C/C4CCC4)C[C@@H]3C)nc2c(F)c1OC |
| InChI | InChI=1S/C22H28FN5O3/c1-13-12-27(17(29)8-7-14-5-4-6-14)9-10-28(13)22-25-19-15(21(24)26-22)11-16(30-2)20(31-3)18(19)23/h7-8,11,13-14H,4-6,9-10,12H2,1-3H3,(H2,24,25,26)/b8-7+/t13-/m0/s1 |
| InChIKey | BQDKCFSSRJEVSB-GWJCSSMESA-N |
| XLogP | 2.76 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|