C17H25ClFN5O3 — CID 121292405
8-fluoro-6-methoxy-7-(2-methoxyethoxy)-2-[(2S)-2-methylpiperazin-1-yl]quinazolin-4-amine;hydrochloride (PubChem CID 121292405) has the molecular formula C17H25ClFN5O3 and a molecular weight of 401.87 g/mol. Its IUPAC name is 8-fluoro-6-methoxy-7-(2-methoxyethoxy)-2-[(2S)-2-methylpiperazin-1-yl]quinazolin-4-amine;hydrochloride.
| Compound Name | 8-fluoro-6-methoxy-7-(2-methoxyethoxy)-2-[(2S)-2-methylpiperazin-1-yl]quinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 121292405 |
| Molecular Formula | C17H25ClFN5O3 |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 8-fluoro-6-methoxy-7-(2-methoxyethoxy)-2-[(2S)-2-methylpiperazin-1-yl]quinazolin-4-amine;hydrochloride |
| SMILES | COCCOc1c(OC)cc2c(N)nc(N3CCNC[C@@H]3C)nc2c1F.Cl |
| InChI | InChI=1S/C17H24FN5O3.ClH/c1-10-9-20-4-5-23(10)17-21-14-11(16(19)22-17)8-12(25-3)15(13(14)18)26-7-6-24-2;/h8,10,20H,4-7,9H2,1-3H3,(H2,19,21,22);1H/t10-;/m0./s1 |
| InChIKey | FMCAKGIDPRMJIW-PPHPATTJSA-N |
| XLogP | 1.60 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|