C21H18BrNO5 — CID 118054707
dimethyl 1-(2-bromo-4-pyridinyl)-7-methoxy-6-methylnaphthalene-2,3-dicarboxylate (PubChem CID 118054707) has the molecular formula C21H18BrNO5 and a molecular weight of 444.28 g/mol. Its IUPAC name is dimethyl 1-(2-bromo-4-pyridinyl)-7-methoxy-6-methylnaphthalene-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(2-bromo-4-pyridinyl)-7-methoxy-6-methylnaphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 118054707 |
| Molecular Formula | C21H18BrNO5 |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | dimethyl 1-(2-bromo-4-pyridinyl)-7-methoxy-6-methylnaphthalene-2,3-dicarboxylate |
| SMILES | COC(=O)c1cc2cc(C)c(OC)cc2c(-c2ccnc(Br)c2)c1C(=O)OC |
| InChI | InChI=1S/C21H18BrNO5/c1-11-7-13-8-15(20(24)27-3)19(21(25)28-4)18(14(13)10-16(11)26-2)12-5-6-23-17(22)9-12/h5-10H,1-4H3 |
| InChIKey | HVDVKEHQHCFWJT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|