About 1-phenylprop-2-ynyl methanesulfinate
1-phenylprop-2-ynyl methanesulfinate (PubChem CID 11805600) has the molecular formula C10H10O2S
and a molecular weight of 194.25 g/mol. Its IUPAC name is 1-phenylprop-2-ynyl methanesulfinate.
Molecular Properties
| Compound Name | 1-phenylprop-2-ynyl methanesulfinate |
| PubChem CID | 11805600 |
| Molecular Formula | C10H10O2S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 1-phenylprop-2-ynyl methanesulfinate |
| SMILES | C#CC(OS(C)=O)c1ccccc1 |
| InChI | InChI=1S/C10H10O2S/c1-3-10(12-13(2)11)9-7-5-4-6-8-9/h1,4-8,10H,2H3 |
| InChIKey | WJGQJMQGSDSFGP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylprop-2-ynyl methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylprop-2-ynyl methanesulfinate?
The IUPAC name of 1-phenylprop-2-ynyl methanesulfinate (CID 11805600) is 1-phenylprop-2-ynyl methanesulfinate.
What is the SMILES notation for 1-phenylprop-2-ynyl methanesulfinate?
The canonical SMILES for 1-phenylprop-2-ynyl methanesulfinate is C#CC(OS(C)=O)c1ccccc1.
What is the InChIKey of 1-phenylprop-2-ynyl methanesulfinate?
The InChIKey is WJGQJMQGSDSFGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2S/c1-3-10(12-13(2)11)9-7-5-4-6-8-9/h1,4-8,10H,2H3.
What are the key properties of 1-phenylprop-2-ynyl methanesulfinate?
1-phenylprop-2-ynyl methanesulfinate has a molecular weight of 194.25 g/mol, XLogP of 1.67, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylprop-2-ynyl methanesulfinate is sourced from PubChem (CID 11805600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).