C23H22O4 — CID 118056056
ethyl 3-cyclopenta-1,3-dien-1-yl-4,4-bis(4-hydroxyphenyl)but-3-enoate (PubChem CID 118056056) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is ethyl 3-cyclopenta-1,3-dien-1-yl-4,4-bis(4-hydroxyphenyl)but-3-enoate.
| Compound Name | ethyl 3-cyclopenta-1,3-dien-1-yl-4,4-bis(4-hydroxyphenyl)but-3-enoate |
|---|---|
| PubChem CID | 118056056 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | ethyl 3-cyclopenta-1,3-dien-1-yl-4,4-bis(4-hydroxyphenyl)but-3-enoate |
| SMILES | CCOC(=O)CC(C1=CC=CC1)=C(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H22O4/c1-2-27-22(26)15-21(16-5-3-4-6-16)23(17-7-11-19(24)12-8-17)18-9-13-20(25)14-10-18/h3-5,7-14,24-25H,2,6,15H2,1H3 |
| InChIKey | LCDDERFFVQJELT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |