C22H21ClO2 — CID 118056063
4-[5-chloro-2-cyclopenta-1,3-dien-1-yl-1-(4-hydroxyphenyl)pent-1-enyl]phenol (PubChem CID 118056063) has the molecular formula C22H21ClO2 and a molecular weight of 352.86 g/mol. Its IUPAC name is 4-[5-chloro-2-cyclopenta-1,3-dien-1-yl-1-(4-hydroxyphenyl)pent-1-enyl]phenol.
| Compound Name | 4-[5-chloro-2-cyclopenta-1,3-dien-1-yl-1-(4-hydroxyphenyl)pent-1-enyl]phenol |
|---|---|
| PubChem CID | 118056063 |
| Molecular Formula | C22H21ClO2 |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 4-[5-chloro-2-cyclopenta-1,3-dien-1-yl-1-(4-hydroxyphenyl)pent-1-enyl]phenol |
| SMILES | Oc1ccc(C(=C(CCCCl)C2=CC=CC2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C22H21ClO2/c23-15-3-6-21(16-4-1-2-5-16)22(17-7-11-19(24)12-8-17)18-9-13-20(25)14-10-18/h1-2,4,7-14,24-25H,3,5-6,15H2 |
| InChIKey | JFEXDQLXHAOUMM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|